luzgrauestrella luzgrauestrella

20-06-2017
Chemistry

contestada

If you cut the ice cube in half, what do you think would happen when it is placed in the alcohol? Please explain your answer.

Respuesta :

BananaBoy09 BananaBoy09

20-06-2017

When an ice cube is cut in half, the surface area increases. This causes an increased speed of physical change (melting in this case) by the ice.

Answer Link

Otras preguntas

Why are we here? How is life even possible?

What was the key to developing an african-american slave community?

A parabolic microphone used on the sidelines of a professional football game uses a reflective dish 24 inches wide and 6 inches deep. How far from the bottom of

List three changes in society, technology, or science that had an impact on the lives of people during Poe lifetime

Why did northern democratic presidents, such as pierce and buchanan, adopt prosouthern policies?

If it takes 13 machines 13 minutes to produce 13 widgets, how many minutes does it take 80 machines to produce 80 widgets?

Robert frost h.g. wells mark twain charles dickens leo tolstoy a. who wrote the road not taken? b. who wrote the war of the worlds? c. who wrote oliver twist? d

Which compound has the highest melting point? ch3(ch2)14cooh ch3(ch2)10ch=ch(ch2)2cooh ch3(ch2)2ch=ch(ch2)4ch=ch(ch2)4cooh ch3(ch2)2ch=ch(ch2)2ch=ch(ch2)2ch=ch(

In the triangle shown above, if theta increases at a constant rate of 3 radians per minute, at what rate is x increasing in units per minute when x equals 3 uni

what is the difference of 3 times a number and 18 is 39. what is the number