18-03-2022
Mathematics

contestada

how many solutions does "-4x" + 10 y = 6 2x - 5y = 8

Respuesta :

brainyuser101USA brainyuser101USA

18-03-2022

Answer:

Infinitely many

Step-by-step explanation:

There are many solutions because 0=0.

Answer Link

Otras preguntas

Which compound has the highest melting point? ch3(ch2)14cooh ch3(ch2)10ch=ch(ch2)2cooh ch3(ch2)2ch=ch(ch2)4ch=ch(ch2)4cooh ch3(ch2)2ch=ch(ch2)2ch=ch(ch2)2ch=ch(

HELPPPP!!! Belinda is a nurse who wants to be able to have quick consultations with other healthcare professionals within the facility where she works. Which t

During the solution focused initial therapy session, it is common for solution focused therapists to ask, "what have you done since you called for the appointme

[tex](6x - 1)(5x + 3) = 0[/tex]solving quadratic equations

Which two elements from the table are MOST likely to form a compound? a) Mg and S b) Na and Ar c) Mg and Ar d) Na and Mg Please provide explanation

WILL GIVE BRAINLIEST! Promoting competition is a key goal of the government. What steps does it take to try to build competition?

Why does King repeat the phrase “i refuse to accept” in this passage

What is the answer for 2(-3+4 plz help me

Lisa gave into peer pressure and consumed alcohol despite the fact that she was on sleeping pills. as a consequence, she lapsed into a coma. this phenomenon is

What is the overall main theme in Utopia by Thomas More ANSWER IN DETAIL