sunilueders92 sunilueders92

16-05-2021
History

contestada

The Nuclear Freeze program came about due to which of the following? A. Cold War B. Korean War C. Vietnam War D. World War II

Respuesta :

kusumabayu264 kusumabayu264

16-05-2021

Answer:

A. Cold War

Explanation:

During competition between america and Soviet union ,nuclear had freezer because

causing chaos everywhere.

Answer Link

Otras preguntas

chlorofluorocarbons(CFCs) damage the ozone layer.Where do these chemicals come from?

Calculate the molar solubility of Ni(OH)2 in water. Use 2.0 * 10^-15 as the solubility product constant of Ni(OH)2.

Which pair of elements is most apt to form an ionic compound with each other?

One way your family can be a positive influence on your mental and emotional health is by helping you _____. A. steal from a store B. telling you to drive

In which city did president kennedy’s assassination take place?

Jeffrey Arnett, the psychologist who created the term emerging adulthood, believes that the developmental period between adolescence and adulthood (emerging adu

__________ involves identifying, describing, and interpreting subject matter in art.

Question 3(Multiple Choice Worth 1 points) (01.01 MC)In the word “champignon” choose the same sound as “am”: “on” “er” “ou” “en” Question 4(Multiple Choice

Which is a spectator ion involved in the reaction of k2cro4(aq) and ba(no3)2(aq)?

Find tan if sin=1/4 and falls in Quadrant 1