Andy100100 Andy100100

19-12-2020
Biology

contestada

Does anyone knows the skeletal structure for this one?

Does anyone knows the skeletal structure for this one class=

Respuesta :

raduoprea160 raduoprea160

19-12-2020

CH3-CH(CH3)-CH2-CH2-CH2-C(CH3)2-CH(CH3)-CH3

it's named

2,3,3,7-tertamethyloctane

Ver imagen raduoprea160

Answer Link

Otras preguntas

How do you become muscular without exercise?

What is the closed linear form of the sequence 5, 7.5, 10, 12.5, 15,..?

how did the involvement with Europeans change how Americans Indians live?

Why is it important for young infants to not be given any solid foods before the recommended 4 - 6 months?

Find The Volume of the Prism

Gregs driveway is 10.35 meters long. Palo's driveway is 10.75 meters long. Whose driveway is longer?

A motorboat travels 216km in 4 hours going upstream. it travels 304km going downstream in the same amount of time. what is the rate of the boat in still water a

Which is the proper procedure for delivering prepared hot food off-site? 1. drive to the off-site location as quickly as possible. 2. cook all fresh foods at th

Find The Surface Area. Geometry

How do you become muscular without exercise?